C26H21F5N2O3 — CID 90716404
(5S)-1-[4-(difluoromethoxy)phenyl]-3-[(1R)-1-phenylethyl]imino-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 90716404) has the molecular formula C26H21F5N2O3 and a molecular weight of 504.46 g/mol. Its IUPAC name is (5S)-1-[4-(difluoromethoxy)phenyl]-3-[(1R)-1-phenylethyl]imino-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | (5S)-1-[4-(difluoromethoxy)phenyl]-3-[(1R)-1-phenylethyl]imino-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90716404 |
| Molecular Formula | C26H21F5N2O3 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | (5S)-1-[4-(difluoromethoxy)phenyl]-3-[(1R)-1-phenylethyl]imino-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | C[C@@H](/N=C1\C[C@@H](c2cccc(OC(F)(F)F)c2)N(c2ccc(OC(F)F)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C26H21F5N2O3/c1-16(17-6-3-2-4-7-17)32-22-15-23(18-8-5-9-21(14-18)36-26(29,30)31)33(24(22)34)19-10-12-20(13-11-19)35-25(27)28/h2-14,16,23,25H,15H2,1H3/b32-22+/t16-,23+/m1/s1 |
| InChIKey | NMIADGBRVOERCN-DRZPCUFBSA-N |
| XLogP | 6.87 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|