C25H20ClF3N2O2 — CID 91403920
(5S)-5-(3-chlorophenyl)-3-[(1R)-1-phenylethyl]imino-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 91403920) has the molecular formula C25H20ClF3N2O2 and a molecular weight of 472.89 g/mol. Its IUPAC name is (5S)-5-(3-chlorophenyl)-3-[(1R)-1-phenylethyl]imino-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-(3-chlorophenyl)-3-[(1R)-1-phenylethyl]imino-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91403920 |
| Molecular Formula | C25H20ClF3N2O2 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (5S)-5-(3-chlorophenyl)-3-[(1R)-1-phenylethyl]imino-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | C[C@@H](/N=C1\C[C@@H](c2cccc(Cl)c2)N(c2ccc(OC(F)(F)F)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C25H20ClF3N2O2/c1-16(17-6-3-2-4-7-17)30-22-15-23(18-8-5-9-19(26)14-18)31(24(22)32)20-10-12-21(13-11-20)33-25(27,28)29/h2-14,16,23H,15H2,1H3/b30-22+/t16-,23+/m1/s1 |
| InChIKey | YAAQDBABEZRDRZ-ZMSYLSLWSA-N |
| XLogP | 6.92 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|