C26H21ClF4N2O2 — CID 87523134
1-(4-chlorophenyl)-4-[[(1R)-1-phenylethyl]amino]-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2H-pyrrol-5-one (PubChem CID 87523134) has the molecular formula C26H21ClF4N2O2 and a molecular weight of 504.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[[(1R)-1-phenylethyl]amino]-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2H-pyrrol-5-one.
| Compound Name | 1-(4-chlorophenyl)-4-[[(1R)-1-phenylethyl]amino]-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 87523134 |
| Molecular Formula | C26H21ClF4N2O2 |
| Molecular Weight | 504.91 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[[(1R)-1-phenylethyl]amino]-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2H-pyrrol-5-one |
| SMILES | C[C@@H](NC1=CC(c2cccc(OC(F)(F)C(F)F)c2)N(c2ccc(Cl)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C26H21ClF4N2O2/c1-16(17-6-3-2-4-7-17)32-22-15-23(33(24(22)34)20-12-10-19(27)11-13-20)18-8-5-9-21(14-18)35-26(30,31)25(28)29/h2-16,23,25,32H,1H3/t16-,23?/m1/s1 |
| InChIKey | XPTPAWJQQOCMJU-ADRQNKRLSA-N |
| XLogP | 6.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.91 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|