C31H33ClF3IN4O2 — CID 143702873
[[3-[4-(4-chlorophenoxy)phenyl]-1-(2-morpholin-4-ylethyl)-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-yl]-ethyl-λ3-iodanyl]formonitrile (PubChem CID 143702873) has the molecular formula C31H33ClF3IN4O2 and a molecular weight of 712.98 g/mol. Its IUPAC name is [[3-[4-(4-chlorophenoxy)phenyl]-1-(2-morpholin-4-ylethyl)-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-yl]-ethyl-λ3-iodanyl]formonitrile.
| Compound Name | [[3-[4-(4-chlorophenoxy)phenyl]-1-(2-morpholin-4-ylethyl)-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-yl]-ethyl-λ3-iodanyl]formonitrile |
|---|---|
| PubChem CID | 143702873 |
| Molecular Formula | C31H33ClF3IN4O2 |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.13 |
| IUPAC Name | [[3-[4-(4-chlorophenoxy)phenyl]-1-(2-morpholin-4-ylethyl)-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-yl]-ethyl-λ3-iodanyl]formonitrile |
| SMILES | CCI(C#N)C1N(CCN2CCOCC2)CC(c2cccc(C(F)(F)F)c2)N1c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H33ClF3IN4O2/c1-2-36(22-37)30-39(15-14-38-16-18-41-19-17-38)21-29(23-4-3-5-24(20-23)31(33,34)35)40(30)26-8-12-28(13-9-26)42-27-10-6-25(32)7-11-27/h3-13,20,29-30H,2,14-19,21H2,1H3 |
| InChIKey | VLLJLDLUIFIWMT-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 51.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|