C17H19NO — CID 143702960
(4-cyclohexa-1,5-dien-1-ylphenyl)-pyrrolidin-1-ylmethanone (PubChem CID 143702960) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is (4-cyclohexa-1,5-dien-1-ylphenyl)-pyrrolidin-1-ylmethanone.
| Compound Name | (4-cyclohexa-1,5-dien-1-ylphenyl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 143702960 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (4-cyclohexa-1,5-dien-1-ylphenyl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(C2=CCCC=C2)cc1)N1CCCC1 |
| InChI | InChI=1S/C17H19NO/c19-17(18-12-4-5-13-18)16-10-8-15(9-11-16)14-6-2-1-3-7-14/h2,6-11H,1,3-5,12-13H2 |
| InChIKey | WWVHYZAEAVXGPU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |