C12H23N3 — CID 143703282
1-(3,4-dihydropyridin-2-yl)-4-methylpiperazine;ethane (PubChem CID 143703282) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 1-(3,4-dihydropyridin-2-yl)-4-methylpiperazine;ethane.
| Compound Name | 1-(3,4-dihydropyridin-2-yl)-4-methylpiperazine;ethane |
|---|---|
| PubChem CID | 143703282 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 1-(3,4-dihydropyridin-2-yl)-4-methylpiperazine;ethane |
| SMILES | CC.CN1CCN(C2=NC=CCC2)CC1 |
| InChI | InChI=1S/C10H17N3.C2H6/c1-12-6-8-13(9-7-12)10-4-2-3-5-11-10;1-2/h3,5H,2,4,6-9H2,1H3;1-2H3 |
| InChIKey | ZDUXEJHOFNVATN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |