C30H45N3 — CID 143705723
(1E)-1-N-ethenyl-2-ethyl-3-N-methyl-1-N-propyl-1-[(E)-[(Z,5E)-5-propylidenedec-6-en-3-yn-2-ylidene]amino]-3-N-prop-2-ynylhexa-1,3-diene-1,3-diamine (PubChem CID 143705723) has the molecular formula C30H45N3 and a molecular weight of 447.71 g/mol. Its IUPAC name is (1E)-1-N-ethenyl-2-ethyl-3-N-methyl-1-N-propyl-1-[(E)-[(Z,5E)-5-propylidenedec-6-en-3-yn-2-ylidene]amino]-3-N-prop-2-ynylhexa-1,3-diene-1,3-diamine.
| Compound Name | (1E)-1-N-ethenyl-2-ethyl-3-N-methyl-1-N-propyl-1-[(E)-[(Z,5E)-5-propylidenedec-6-en-3-yn-2-ylidene]amino]-3-N-prop-2-ynylhexa-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 143705723 |
| Molecular Formula | C30H45N3 |
| Molecular Weight | 447.71 g/mol |
| Exact Mass | 447.36 |
| IUPAC Name | (1E)-1-N-ethenyl-2-ethyl-3-N-methyl-1-N-propyl-1-[(E)-[(Z,5E)-5-propylidenedec-6-en-3-yn-2-ylidene]amino]-3-N-prop-2-ynylhexa-1,3-diene-1,3-diamine |
| SMILES | C#CCN(C)C(=CCC)/C(CC)=C(/N=C(\C)C#CC(/C=C\CCC)=C/CC)N(C=C)CCC |
| InChI | InChI=1S/C30H45N3/c1-10-17-18-21-27(19-11-2)23-22-26(8)31-30(33(16-7)25-14-5)28(15-6)29(20-12-3)32(9)24-13-4/h4,16,18-21H,7,10-12,14-15,17,24-25H2,1-3,5-6,8-9H3/b21-18-,27-19+,29-20?,30-28-,31-26+ |
| InChIKey | UZVJGXXPZBOMOF-SOZHFFKBSA-N |
| XLogP | 7.48 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.71 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|