C27H38N2+2 — CID 91377458
butyl-[5-[but-3-ynyl(ethylidene)azaniumyl]-6-prop-1-en-2-ylnona-1,5,7-trien-3-yn-2-yl]-pent-2-enylideneazanium (PubChem CID 91377458) has the molecular formula C27H38N2+2 and a molecular weight of 390.62 g/mol. Its IUPAC name is butyl-[5-[but-3-ynyl(ethylidene)azaniumyl]-6-prop-1-en-2-ylnona-1,5,7-trien-3-yn-2-yl]-pent-2-enylideneazanium.
| Compound Name | butyl-[5-[but-3-ynyl(ethylidene)azaniumyl]-6-prop-1-en-2-ylnona-1,5,7-trien-3-yn-2-yl]-pent-2-enylideneazanium |
|---|---|
| PubChem CID | 91377458 |
| Molecular Formula | C27H38N2+2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | butyl-[5-[but-3-ynyl(ethylidene)azaniumyl]-6-prop-1-en-2-ylnona-1,5,7-trien-3-yn-2-yl]-pent-2-enylideneazanium |
| SMILES | C#CCC/[N+](=C\C)C(C#CC(=C)/[N+](=C/C=CCC)CCCC)=C(C=CC)C(=C)C |
| InChI | InChI=1S/C27H38N2/c1-9-14-17-23-29(22-16-11-3)25(8)19-20-27(26(18-12-4)24(6)7)28(13-5)21-15-10-2/h2,12-14,17-18,23H,6,8-9,11,15-16,21-22H2,1,3-5,7H3/q+2/b17-14?,18-12?,27-26?,28-13+,29-23+ |
| InChIKey | YWQJDXWUIYSQNH-NJZIAPLTSA-N |
| XLogP | 5.89 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|