C22H31ClN4O — CID 143705982
(Z)-N-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-imino-4-piperidin-1-ylbut-2-enamide (PubChem CID 143705982) has the molecular formula C22H31ClN4O and a molecular weight of 402.97 g/mol. Its IUPAC name is (Z)-N-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-imino-4-piperidin-1-ylbut-2-enamide.
| Compound Name | (Z)-N-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-imino-4-piperidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 143705982 |
| Molecular Formula | C22H31ClN4O |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (Z)-N-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-imino-4-piperidin-1-ylbut-2-enamide |
| SMILES | [H]/N=C(/C=C\C(=O)NC1CCC(CN)(c2cccc(Cl)c2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C22H31ClN4O/c23-18-6-4-5-17(15-18)22(16-24)11-9-19(10-12-22)26-21(28)8-7-20(25)27-13-2-1-3-14-27/h4-8,15,19,25H,1-3,9-14,16,24H2,(H,26,28)/b8-7-,25-20- |
| InChIKey | CTUKKHOCYBPBFN-RNORZAPUSA-N |
| XLogP | 3.61 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|