C19H23Cl2N3O — CID 71184788
N-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]pyridine-4-carboxamide;hydrochloride (PubChem CID 71184788) has the molecular formula C19H23Cl2N3O and a molecular weight of 380.32 g/mol. Its IUPAC name is N-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]pyridine-4-carboxamide;hydrochloride.
| Compound Name | N-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]pyridine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 71184788 |
| Molecular Formula | C19H23Cl2N3O |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]pyridine-4-carboxamide;hydrochloride |
| SMILES | Cl.NCC1(c2cccc(Cl)c2)CCC(NC(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C19H22ClN3O.ClH/c20-16-3-1-2-15(12-16)19(13-21)8-4-17(5-9-19)23-18(24)14-6-10-22-11-7-14;/h1-3,6-7,10-12,17H,4-5,8-9,13,21H2,(H,23,24);1H |
| InChIKey | BCHOJNSQTNPLBN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |