C28H31ClN4O4 — CID 71184753
2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-N-cyclopropyl-3-oxo-6-phenylpyridazine-4-carboxamide;formic acid (PubChem CID 71184753) has the molecular formula C28H31ClN4O4 and a molecular weight of 523.03 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-N-cyclopropyl-3-oxo-6-phenylpyridazine-4-carboxamide;formic acid.
| Compound Name | 2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-N-cyclopropyl-3-oxo-6-phenylpyridazine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 71184753 |
| Molecular Formula | C28H31ClN4O4 |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-N-cyclopropyl-3-oxo-6-phenylpyridazine-4-carboxamide;formic acid |
| SMILES | NCC1(c2cccc(Cl)c2)CCC(n2nc(-c3ccccc3)cc(C(=O)NC3CC3)c2=O)CC1.O=CO |
| InChI | InChI=1S/C27H29ClN4O2.CH2O2/c28-20-8-4-7-19(15-20)27(17-29)13-11-22(12-14-27)32-26(34)23(25(33)30-21-9-10-21)16-24(31-32)18-5-2-1-3-6-18;2-1-3/h1-8,15-16,21-22H,9-14,17,29H2,(H,30,33);1H,(H,2,3) |
| InChIKey | HEWOXWBCIIHSQR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|