C24H26ClN3O — CID 70296028
2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-6-(4-methylphenyl)pyridazin-3-one (PubChem CID 70296028) has the molecular formula C24H26ClN3O and a molecular weight of 407.95 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-6-(4-methylphenyl)pyridazin-3-one.
| Compound Name | 2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-6-(4-methylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 70296028 |
| Molecular Formula | C24H26ClN3O |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-6-(4-methylphenyl)pyridazin-3-one |
| SMILES | Cc1ccc(-c2ccc(=O)n(C3CCC(CN)(c4cccc(Cl)c4)CC3)n2)cc1 |
| InChI | InChI=1S/C24H26ClN3O/c1-17-5-7-18(8-6-17)22-9-10-23(29)28(27-22)21-11-13-24(16-26,14-12-21)19-3-2-4-20(25)15-19/h2-10,15,21H,11-14,16,26H2,1H3 |
| InChIKey | MKGYRJDBQVWCEO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |