C24H26ClN5O2 — CID 174584804
N-[[2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-oxo-6-phenylpyridazin-4-yl]amino]formamide (PubChem CID 174584804) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is N-[[2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-oxo-6-phenylpyridazin-4-yl]amino]formamide.
| Compound Name | N-[[2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-oxo-6-phenylpyridazin-4-yl]amino]formamide |
|---|---|
| PubChem CID | 174584804 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[[2-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-oxo-6-phenylpyridazin-4-yl]amino]formamide |
| SMILES | NCC1(c2cccc(Cl)c2)CCC(n2nc(-c3ccccc3)cc(NNC=O)c2=O)CC1 |
| InChI | InChI=1S/C24H26ClN5O2/c25-19-8-4-7-18(13-19)24(15-26)11-9-20(10-12-24)30-23(32)22(28-27-16-31)14-21(29-30)17-5-2-1-3-6-17/h1-8,13-14,16,20,28H,9-12,15,26H2,(H,27,31) |
| InChIKey | OGNHTIJNNYQPFW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|