C28H33ClN4O3 — CID 70296288
3-[1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)benzamide (PubChem CID 70296288) has the molecular formula C28H33ClN4O3 and a molecular weight of 509.05 g/mol. Its IUPAC name is 3-[1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-[1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 70296288 |
| Molecular Formula | C28H33ClN4O3 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 3-[1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cccc(-c2ccc(=O)n(C3CCC(CN)(c4cccc(Cl)c4)CC3)n2)c1 |
| InChI | InChI=1S/C28H33ClN4O3/c1-36-16-4-15-31-27(35)21-6-2-5-20(17-21)25-9-10-26(34)33(32-25)24-11-13-28(19-30,14-12-24)22-7-3-8-23(29)18-22/h2-3,5-10,17-18,24H,4,11-16,19,30H2,1H3,(H,31,35) |
| InChIKey | LLEVKGNYPFVSGF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|