C28H32ClN3O3 — CID 71202341
3-[1-[4-(3-chlorophenyl)-4-methylcyclohexyl]-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)benzamide (PubChem CID 71202341) has the molecular formula C28H32ClN3O3 and a molecular weight of 494.04 g/mol. Its IUPAC name is 3-[1-[4-(3-chlorophenyl)-4-methylcyclohexyl]-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-[1-[4-(3-chlorophenyl)-4-methylcyclohexyl]-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 71202341 |
| Molecular Formula | C28H32ClN3O3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-[1-[4-(3-chlorophenyl)-4-methylcyclohexyl]-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cccc(-c2ccc(=O)n(C3CCC(C)(c4cccc(Cl)c4)CC3)n2)c1 |
| InChI | InChI=1S/C28H32ClN3O3/c1-28(22-8-4-9-23(29)19-22)14-12-24(13-15-28)32-26(33)11-10-25(31-32)20-6-3-7-21(18-20)27(34)30-16-5-17-35-2/h3-4,6-11,18-19,24H,5,12-17H2,1-2H3,(H,30,34) |
| InChIKey | LYXPGTOASLQOGE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|