C23H28ClN3O — CID 70295374
1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-phenylpiperazin-2-one (PubChem CID 70295374) has the molecular formula C23H28ClN3O and a molecular weight of 397.95 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-phenylpiperazin-2-one.
| Compound Name | 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 70295374 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-phenylpiperazin-2-one |
| SMILES | NCC1(c2cccc(Cl)c2)CCC(N2CCN(c3ccccc3)CC2=O)CC1 |
| InChI | InChI=1S/C23H28ClN3O/c24-19-6-4-5-18(15-19)23(17-25)11-9-21(10-12-23)27-14-13-26(16-22(27)28)20-7-2-1-3-8-20/h1-8,15,21H,9-14,16-17,25H2 |
| InChIKey | LTIDGBLNNHWGPT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |