C24H28ClN3O2 — CID 71184394
1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-benzylpiperazine-2,5-dione (PubChem CID 71184394) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-benzylpiperazine-2,5-dione.
| Compound Name | 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-benzylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 71184394 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-benzylpiperazine-2,5-dione |
| SMILES | NCC1(c2cccc(Cl)c2)CCC(N2CC(=O)NC(Cc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C24H28ClN3O2/c25-19-8-4-7-18(14-19)24(16-26)11-9-20(10-12-24)28-15-22(29)27-21(23(28)30)13-17-5-2-1-3-6-17/h1-8,14,20-21H,9-13,15-16,26H2,(H,27,29) |
| InChIKey | ZGOZALYPCZETIC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |