C20H30ClN3O — CID 71184611
1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-butylimidazolidin-2-one (PubChem CID 71184611) has the molecular formula C20H30ClN3O and a molecular weight of 363.93 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-butylimidazolidin-2-one.
| Compound Name | 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-butylimidazolidin-2-one |
|---|---|
| PubChem CID | 71184611 |
| Molecular Formula | C20H30ClN3O |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-butylimidazolidin-2-one |
| SMILES | CCCCN1CCN(C2CCC(CN)(c3cccc(Cl)c3)CC2)C1=O |
| InChI | InChI=1S/C20H30ClN3O/c1-2-3-11-23-12-13-24(19(23)25)18-7-9-20(15-22,10-8-18)16-5-4-6-17(21)14-16/h4-6,14,18H,2-3,7-13,15,22H2,1H3 |
| InChIKey | FRBVXKCDYNZDGR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |