C18H25N3O2 — CID 143706143
1-[4-(aminomethyl)-4-(3-methylphenyl)cyclohexyl]piperazine-2,5-dione (PubChem CID 143706143) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-4-(3-methylphenyl)cyclohexyl]piperazine-2,5-dione.
| Compound Name | 1-[4-(aminomethyl)-4-(3-methylphenyl)cyclohexyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 143706143 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-[4-(aminomethyl)-4-(3-methylphenyl)cyclohexyl]piperazine-2,5-dione |
| SMILES | Cc1cccc(C2(CN)CCC(N3CC(=O)NCC3=O)CC2)c1 |
| InChI | InChI=1S/C18H25N3O2/c1-13-3-2-4-14(9-13)18(12-19)7-5-15(6-8-18)21-11-16(22)20-10-17(21)23/h2-4,9,15H,5-8,10-12,19H2,1H3,(H,20,22) |
| InChIKey | OXEMCAINFNZZMO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |