C23H31Cl2N3O — CID 174600043
1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-phenylpiperazin-2-ol;hydrochloride (PubChem CID 174600043) has the molecular formula C23H31Cl2N3O and a molecular weight of 436.43 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-phenylpiperazin-2-ol;hydrochloride.
| Compound Name | 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-phenylpiperazin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 174600043 |
| Molecular Formula | C23H31Cl2N3O |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-4-phenylpiperazin-2-ol;hydrochloride |
| SMILES | Cl.NCC1(c2cccc(Cl)c2)CCC(N2CCN(c3ccccc3)CC2O)CC1 |
| InChI | InChI=1S/C23H30ClN3O.ClH/c24-19-6-4-5-18(15-19)23(17-25)11-9-21(10-12-23)27-14-13-26(16-22(27)28)20-7-2-1-3-8-20;/h1-8,15,21-22,28H,9-14,16-17,25H2;1H |
| InChIKey | XXEICDORPFCZRI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |