C18H21ClN2 — CID 143706000
[1-(3-chlorocyclohexa-1,5-dien-1-yl)-4-pyridin-3-ylcyclohex-3-en-1-yl]methanamine (PubChem CID 143706000) has the molecular formula C18H21ClN2 and a molecular weight of 300.83 g/mol. Its IUPAC name is [1-(3-chlorocyclohexa-1,5-dien-1-yl)-4-pyridin-3-ylcyclohex-3-en-1-yl]methanamine.
| Compound Name | [1-(3-chlorocyclohexa-1,5-dien-1-yl)-4-pyridin-3-ylcyclohex-3-en-1-yl]methanamine |
|---|---|
| PubChem CID | 143706000 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [1-(3-chlorocyclohexa-1,5-dien-1-yl)-4-pyridin-3-ylcyclohex-3-en-1-yl]methanamine |
| SMILES | NCC1(C2=CC(Cl)CC=C2)CC=C(c2cccnc2)CC1 |
| InChI | InChI=1S/C18H21ClN2/c19-17-5-1-4-16(11-17)18(13-20)8-6-14(7-9-18)15-3-2-10-21-12-15/h1-4,6,10-12,17H,5,7-9,13,20H2 |
| InChIKey | VTYXOKCACNMAFM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|