C9H8ClN3 — CID 91434978
2-chloro-4-pyridin-3-yl-2,5-dihydropyrimidine (PubChem CID 91434978) has the molecular formula C9H8ClN3 and a molecular weight of 193.64 g/mol. Its IUPAC name is 2-chloro-4-pyridin-3-yl-2,5-dihydropyrimidine.
| Compound Name | 2-chloro-4-pyridin-3-yl-2,5-dihydropyrimidine |
|---|---|
| PubChem CID | 91434978 |
| Molecular Formula | C9H8ClN3 |
| Molecular Weight | 193.64 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 2-chloro-4-pyridin-3-yl-2,5-dihydropyrimidine |
| SMILES | ClC1N=CCC(c2cccnc2)=N1 |
| InChI | InChI=1S/C9H8ClN3/c10-9-12-5-3-8(13-9)7-2-1-4-11-6-7/h1-2,4-6,9H,3H2 |
| InChIKey | HITFPPLNXJNBNX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.64 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|