C22H18F4IN5O2S — CID 143706583
4-[[[8-(4-fluorophenyl)-5-(2,2,2-trifluoroethylamino)-7λ3-ioda-2,4-diazabicyclo[4.4.0]deca-1(6),2,4,7,9-pentaen-3-yl]amino]methyl]benzenesulfonamide (PubChem CID 143706583) has the molecular formula C22H18F4IN5O2S and a molecular weight of 619.38 g/mol. Its IUPAC name is 4-[[[8-(4-fluorophenyl)-5-(2,2,2-trifluoroethylamino)-7λ3-ioda-2,4-diazabicyclo[4.4.0]deca-1(6),2,4,7,9-pentaen-3-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[8-(4-fluorophenyl)-5-(2,2,2-trifluoroethylamino)-7λ3-ioda-2,4-diazabicyclo[4.4.0]deca-1(6),2,4,7,9-pentaen-3-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 143706583 |
| Molecular Formula | C22H18F4IN5O2S |
| Molecular Weight | 619.38 g/mol |
| Exact Mass | 619.02 |
| IUPAC Name | 4-[[[8-(4-fluorophenyl)-5-(2,2,2-trifluoroethylamino)-7λ3-ioda-2,4-diazabicyclo[4.4.0]deca-1(6),2,4,7,9-pentaen-3-yl]amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2nc3c(c(NCC(F)(F)F)n2)I=C(c2ccc(F)cc2)C=C3)cc1 |
| InChI | InChI=1S/C22H18F4IN5O2S/c23-15-5-3-14(4-6-15)17-9-10-18-19(27-17)20(30-12-22(24,25)26)32-21(31-18)29-11-13-1-7-16(8-2-13)35(28,33)34/h1-10H,11-12H2,(H2,28,33,34)(H2,29,30,31,32) |
| InChIKey | GNJWUBKLQRPQQJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|