C25H26N6O2 — CID 143708720
N-[1-(2-hydroxyphenyl)-3-(methylamino)-3-pyridin-3-ylpropyl]-1-(6-methyl-2-pyridinyl)imidazole-4-carboxamide (PubChem CID 143708720) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)-3-(methylamino)-3-pyridin-3-ylpropyl]-1-(6-methyl-2-pyridinyl)imidazole-4-carboxamide.
| Compound Name | N-[1-(2-hydroxyphenyl)-3-(methylamino)-3-pyridin-3-ylpropyl]-1-(6-methyl-2-pyridinyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 143708720 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)-3-(methylamino)-3-pyridin-3-ylpropyl]-1-(6-methyl-2-pyridinyl)imidazole-4-carboxamide |
| SMILES | CNC(CC(NC(=O)c1cn(-c2cccc(C)n2)cn1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C25H26N6O2/c1-17-7-5-11-24(29-17)31-15-22(28-16-31)25(33)30-21(19-9-3-4-10-23(19)32)13-20(26-2)18-8-6-12-27-14-18/h3-12,14-16,20-21,26,32H,13H2,1-2H3,(H,30,33) |
| InChIKey | LSTCTJJRNAISCC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|