C17H16N6OS — CID 1485012
1-[[1-(6-methyl-2-pyridinyl)imidazole-4-carbonyl]amino]-3-phenylthiourea (PubChem CID 1485012) has the molecular formula C17H16N6OS and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-[[1-(6-methyl-2-pyridinyl)imidazole-4-carbonyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[1-(6-methyl-2-pyridinyl)imidazole-4-carbonyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 1485012 |
| Molecular Formula | C17H16N6OS |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-[[1-(6-methyl-2-pyridinyl)imidazole-4-carbonyl]amino]-3-phenylthiourea |
| SMILES | Cc1cccc(-n2cnc(C(=O)NNC(=S)Nc3ccccc3)c2)n1 |
| InChI | InChI=1S/C17H16N6OS/c1-12-6-5-9-15(19-12)23-10-14(18-11-23)16(24)21-22-17(25)20-13-7-3-2-4-8-13/h2-11H,1H3,(H,21,24)(H2,20,22,25) |
| InChIKey | HZIHMEUDXCSJHM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|