C18H17N5O2 — CID 1485013
N'-(4-methylbenzoyl)-1-(6-methyl-2-pyridinyl)imidazole-4-carbohydrazide (PubChem CID 1485013) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N'-(4-methylbenzoyl)-1-(6-methyl-2-pyridinyl)imidazole-4-carbohydrazide.
| Compound Name | N'-(4-methylbenzoyl)-1-(6-methyl-2-pyridinyl)imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 1485013 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N'-(4-methylbenzoyl)-1-(6-methyl-2-pyridinyl)imidazole-4-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2cn(-c3cccc(C)n3)cn2)cc1 |
| InChI | InChI=1S/C18H17N5O2/c1-12-6-8-14(9-7-12)17(24)21-22-18(25)15-10-23(11-19-15)16-5-3-4-13(2)20-16/h3-11H,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | QEOWIBCHCYBRDO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|