C23H20N4O3S2 — CID 143708788
N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-pyridin-2-ylthiophene-2-sulfonamide (PubChem CID 143708788) has the molecular formula C23H20N4O3S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-pyridin-2-ylthiophene-2-sulfonamide.
| Compound Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 143708788 |
| Molecular Formula | C23H20N4O3S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
| SMILES | [H]/N=C(/CC(NS(=O)(=O)c1ccc(-c2ccccn2)s1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C23H20N4O3S2/c24-18(16-6-5-12-25-15-16)14-20(17-7-1-2-9-21(17)28)27-32(29,30)23-11-10-22(31-23)19-8-3-4-13-26-19/h1-13,15,20,24,27-28H,14H2/b24-18- |
| InChIKey | QXHJXTQQTDVKKM-MOHJPFBDSA-N |
| XLogP | 4.39 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|