C28H25N4O3- — CID 143708792
[3-(2-hydroxyphenyl)-3-[[3-[hydroxy(phenyl)methyl]phenyl]carbamoylamino]-1-pyridin-3-ylpropylidene]azanide (PubChem CID 143708792) has the molecular formula C28H25N4O3- and a molecular weight of 465.53 g/mol. Its IUPAC name is [3-(2-hydroxyphenyl)-3-[[3-[hydroxy(phenyl)methyl]phenyl]carbamoylamino]-1-pyridin-3-ylpropylidene]azanide.
| Compound Name | [3-(2-hydroxyphenyl)-3-[[3-[hydroxy(phenyl)methyl]phenyl]carbamoylamino]-1-pyridin-3-ylpropylidene]azanide |
|---|---|
| PubChem CID | 143708792 |
| Molecular Formula | C28H25N4O3- |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [3-(2-hydroxyphenyl)-3-[[3-[hydroxy(phenyl)methyl]phenyl]carbamoylamino]-1-pyridin-3-ylpropylidene]azanide |
| SMILES | [N-]=C(CC(NC(=O)Nc1cccc(C(O)c2ccccc2)c1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C28H25N4O3/c29-24(21-11-7-15-30-18-21)17-25(23-13-4-5-14-26(23)33)32-28(35)31-22-12-6-10-20(16-22)27(34)19-8-2-1-3-9-19/h1-16,18,25,27,33-34H,17H2,(H2,31,32,35)/q-1 |
| InChIKey | KGVPJBZSFHJPFJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|