C28H26N4O3 — CID 143708884
1-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-3-(2-phenylmethoxyphenyl)urea (PubChem CID 143708884) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is 1-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-3-(2-phenylmethoxyphenyl)urea.
| Compound Name | 1-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-3-(2-phenylmethoxyphenyl)urea |
|---|---|
| PubChem CID | 143708884 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 1-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-3-(2-phenylmethoxyphenyl)urea |
| SMILES | [H]/N=C(/CC(NC(=O)Nc1ccccc1OCc1ccccc1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C28H26N4O3/c29-23(21-11-8-16-30-18-21)17-25(22-12-4-6-14-26(22)33)32-28(34)31-24-13-5-7-15-27(24)35-19-20-9-2-1-3-10-20/h1-16,18,25,29,33H,17,19H2,(H2,31,32,34)/b29-23- |
| InChIKey | OFXBQRJOJSJVKX-FAJYDZGRSA-N |
| XLogP | 5.69 |
| TPSA | 107.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|