C25H24N5O2S+ — CID 143708632
[3-[[2-(benzylamino)-1,3-thiazole-5-carbonyl]amino]-3-(2-hydroxyphenyl)-1-pyridin-3-ylpropylidene]azanium (PubChem CID 143708632) has the molecular formula C25H24N5O2S+ and a molecular weight of 458.57 g/mol. Its IUPAC name is [3-[[2-(benzylamino)-1,3-thiazole-5-carbonyl]amino]-3-(2-hydroxyphenyl)-1-pyridin-3-ylpropylidene]azanium.
| Compound Name | [3-[[2-(benzylamino)-1,3-thiazole-5-carbonyl]amino]-3-(2-hydroxyphenyl)-1-pyridin-3-ylpropylidene]azanium |
|---|---|
| PubChem CID | 143708632 |
| Molecular Formula | C25H24N5O2S+ |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | [3-[[2-(benzylamino)-1,3-thiazole-5-carbonyl]amino]-3-(2-hydroxyphenyl)-1-pyridin-3-ylpropylidene]azanium |
| SMILES | [NH2+]=C(CC(NC(=O)c1cnc(NCc2ccccc2)s1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C25H23N5O2S/c26-20(18-9-6-12-27-15-18)13-21(19-10-4-5-11-22(19)31)30-24(32)23-16-29-25(33-23)28-14-17-7-2-1-3-8-17/h1-12,15-16,21,26,31H,13-14H2,(H,28,29)(H,30,32)/p+1 |
| InChIKey | SISXQOIMPGETLM-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|