C26H21N3O4S — CID 143708818
4-[5-[[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]carbamoyl]thiophen-2-yl]benzoic acid (PubChem CID 143708818) has the molecular formula C26H21N3O4S and a molecular weight of 471.54 g/mol. Its IUPAC name is 4-[5-[[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]carbamoyl]thiophen-2-yl]benzoic acid.
| Compound Name | 4-[5-[[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]carbamoyl]thiophen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 143708818 |
| Molecular Formula | C26H21N3O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 4-[5-[[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]carbamoyl]thiophen-2-yl]benzoic acid |
| SMILES | [H]/N=C(/CC(NC(=O)c1ccc(-c2ccc(C(=O)O)cc2)s1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C26H21N3O4S/c27-20(18-4-3-13-28-15-18)14-21(19-5-1-2-6-22(19)30)29-25(31)24-12-11-23(34-24)16-7-9-17(10-8-16)26(32)33/h1-13,15,21,27,30H,14H2,(H,29,31)(H,32,33)/b27-20- |
| InChIKey | GVYGHAFHLQDBNW-OOAXWGSJSA-N |
| XLogP | 5.14 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|