C24H19ClN4O2S — CID 143708772
2-(3-chlorophenyl)-N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-1,3-thiazole-4-carboxamide (PubChem CID 143708772) has the molecular formula C24H19ClN4O2S and a molecular weight of 462.96 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 143708772 |
| Molecular Formula | C24H19ClN4O2S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-1,3-thiazole-4-carboxamide |
| SMILES | [H]/N=C(/CC(NC(=O)c1csc(-c2cccc(Cl)c2)n1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C24H19ClN4O2S/c25-17-7-3-5-15(11-17)24-29-21(14-32-24)23(31)28-20(18-8-1-2-9-22(18)30)12-19(26)16-6-4-10-27-13-16/h1-11,13-14,20,26,30H,12H2,(H,28,31)/b26-19- |
| InChIKey | ZXGVDZPBUVHCLA-XHPQRKPJSA-N |
| XLogP | 5.49 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|