C27H30N4O4 — CID 143708753
1-(3-cyclopentyloxy-4-methoxyphenyl)-3-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]urea (PubChem CID 143708753) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 1-(3-cyclopentyloxy-4-methoxyphenyl)-3-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]urea.
| Compound Name | 1-(3-cyclopentyloxy-4-methoxyphenyl)-3-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]urea |
|---|---|
| PubChem CID | 143708753 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1-(3-cyclopentyloxy-4-methoxyphenyl)-3-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]urea |
| SMILES | [H]/N=C(/CC(NC(=O)Nc1ccc(OC)c(OC2CCCC2)c1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C27H30N4O4/c1-34-25-13-12-19(15-26(25)35-20-8-2-3-9-20)30-27(33)31-23(21-10-4-5-11-24(21)32)16-22(28)18-7-6-14-29-17-18/h4-7,10-15,17,20,23,28,32H,2-3,8-9,16H2,1H3,(H2,30,31,33)/b28-22- |
| InChIKey | UUCYYTWPRZWAJI-SLMZUGIISA-N |
| XLogP | 5.44 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|