C25H33N3O4 — CID 55577235
2-(benzylcarbamoylamino)-N-(3-cyclopentyloxy-4-methoxyphenyl)-3-methylbutanamide (PubChem CID 55577235) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-N-(3-cyclopentyloxy-4-methoxyphenyl)-3-methylbutanamide.
| Compound Name | 2-(benzylcarbamoylamino)-N-(3-cyclopentyloxy-4-methoxyphenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 55577235 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-(benzylcarbamoylamino)-N-(3-cyclopentyloxy-4-methoxyphenyl)-3-methylbutanamide |
| SMILES | COc1ccc(NC(=O)C(NC(=O)NCc2ccccc2)C(C)C)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H33N3O4/c1-17(2)23(28-25(30)26-16-18-9-5-4-6-10-18)24(29)27-19-13-14-21(31-3)22(15-19)32-20-11-7-8-12-20/h4-6,9-10,13-15,17,20,23H,7-8,11-12,16H2,1-3H3,(H,27,29)(H2,26,28,30) |
| InChIKey | QXBHTVVYFRKSIM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |