C21H27N3O3 — CID 166237399
1-[(3-amino-5-methylphenyl)methyl]-3-(3-cyclopentyloxy-4-methoxyphenyl)urea (PubChem CID 166237399) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[(3-amino-5-methylphenyl)methyl]-3-(3-cyclopentyloxy-4-methoxyphenyl)urea.
| Compound Name | 1-[(3-amino-5-methylphenyl)methyl]-3-(3-cyclopentyloxy-4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 166237399 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-[(3-amino-5-methylphenyl)methyl]-3-(3-cyclopentyloxy-4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NCc2cc(C)cc(N)c2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H27N3O3/c1-14-9-15(11-16(22)10-14)13-23-21(25)24-17-7-8-19(26-2)20(12-17)27-18-5-3-4-6-18/h7-12,18H,3-6,13,22H2,1-2H3,(H2,23,24,25) |
| InChIKey | MEIGHHHYWDYKRF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|