C22H35N3O4 — CID 47033937
1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(2-methyl-2-morpholin-4-ylbutyl)urea (PubChem CID 47033937) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(2-methyl-2-morpholin-4-ylbutyl)urea.
| Compound Name | 1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(2-methyl-2-morpholin-4-ylbutyl)urea |
|---|---|
| PubChem CID | 47033937 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(2-methyl-2-morpholin-4-ylbutyl)urea |
| SMILES | CCC(C)(CNC(=O)Nc1ccc(OC)c(OC2CCCC2)c1)N1CCOCC1 |
| InChI | InChI=1S/C22H35N3O4/c1-4-22(2,25-11-13-28-14-12-25)16-23-21(26)24-17-9-10-19(27-3)20(15-17)29-18-7-5-6-8-18/h9-10,15,18H,4-8,11-14,16H2,1-3H3,(H2,23,24,26) |
| InChIKey | BVRADJDLBGVRCS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |