C24H20N4O2S — CID 89256906
N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-pyridin-2-ylthiophene-2-carboxamide (PubChem CID 89256906) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-pyridin-2-ylthiophene-2-carboxamide.
| Compound Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-pyridin-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 89256906 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-pyridin-2-ylthiophene-2-carboxamide |
| SMILES | [H]/N=C(/CC(NC(=O)c1ccc(-c2ccccn2)s1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C24H20N4O2S/c25-18(16-6-5-12-26-15-16)14-20(17-7-1-2-9-21(17)29)28-24(30)23-11-10-22(31-23)19-8-3-4-13-27-19/h1-13,15,20,25,29H,14H2,(H,28,30)/b25-18- |
| InChIKey | WKBGGGVJHVFAIW-BWAHOGKJSA-N |
| XLogP | 4.84 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|