C21H22N3O5S+ — CID 143708692
dihydroxy-[4-[[1-(3-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]carbamoyl]-2,5-dimethylfuran-3-yl]sulfanium (PubChem CID 143708692) has the molecular formula C21H22N3O5S+ and a molecular weight of 428.49 g/mol. Its IUPAC name is dihydroxy-[4-[[1-(3-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]carbamoyl]-2,5-dimethylfuran-3-yl]sulfanium.
| Compound Name | dihydroxy-[4-[[1-(3-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]carbamoyl]-2,5-dimethylfuran-3-yl]sulfanium |
|---|---|
| PubChem CID | 143708692 |
| Molecular Formula | C21H22N3O5S+ |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | dihydroxy-[4-[[1-(3-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]carbamoyl]-2,5-dimethylfuran-3-yl]sulfanium |
| SMILES | [H]/N=C(/CC(NC(=O)c1c(C)oc(C)c1[S+](O)O)c1cccc(O)c1)c1cccnc1 |
| InChI | InChI=1S/C21H21N3O5S/c1-12-19(20(30(27)28)13(2)29-12)21(26)24-18(14-5-3-7-16(25)9-14)10-17(22)15-6-4-8-23-11-15/h3-9,11,18,22,27-28H,10H2,1-2H3,(H-,24,25,26)/p+1/b22-17- |
| InChIKey | PLXWQTMJSSGTFD-XLNRJJMWSA-O |
| XLogP | 3.85 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|