C26H20N4O2S — CID 143708749
N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-(2-pyridin-2-ylethynyl)thiophene-2-carboxamide (PubChem CID 143708749) has the molecular formula C26H20N4O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-(2-pyridin-2-ylethynyl)thiophene-2-carboxamide.
| Compound Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-(2-pyridin-2-ylethynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143708749 |
| Molecular Formula | C26H20N4O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-5-(2-pyridin-2-ylethynyl)thiophene-2-carboxamide |
| SMILES | [H]/N=C(/CC(NC(=O)c1ccc(C#Cc2ccccn2)s1)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C26H20N4O2S/c27-22(18-6-5-14-28-17-18)16-23(21-8-1-2-9-24(21)31)30-26(32)25-13-12-20(33-25)11-10-19-7-3-4-15-29-19/h1-9,12-15,17,23,27,31H,16H2,(H,30,32)/b27-22- |
| InChIKey | MWWBHHOTYVMAEB-QYQHSDTDSA-N |
| XLogP | 4.57 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|