C25H25N4O3+ — CID 163761483
[3-(2-hydroxyphenyl)-3-[(2-oxo-1-phenylpyrrolidine-3-carbonyl)amino]-1-pyridin-3-ylpropylidene]azanium (PubChem CID 163761483) has the molecular formula C25H25N4O3+ and a molecular weight of 429.50 g/mol. Its IUPAC name is [3-(2-hydroxyphenyl)-3-[(2-oxo-1-phenylpyrrolidine-3-carbonyl)amino]-1-pyridin-3-ylpropylidene]azanium.
| Compound Name | [3-(2-hydroxyphenyl)-3-[(2-oxo-1-phenylpyrrolidine-3-carbonyl)amino]-1-pyridin-3-ylpropylidene]azanium |
|---|---|
| PubChem CID | 163761483 |
| Molecular Formula | C25H25N4O3+ |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [3-(2-hydroxyphenyl)-3-[(2-oxo-1-phenylpyrrolidine-3-carbonyl)amino]-1-pyridin-3-ylpropylidene]azanium |
| SMILES | [NH2+]=C(CC(NC(=O)C1CCN(c2ccccc2)C1=O)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C25H24N4O3/c26-21(17-7-6-13-27-16-17)15-22(19-10-4-5-11-23(19)30)28-24(31)20-12-14-29(25(20)32)18-8-2-1-3-9-18/h1-11,13,16,20,22,26,30H,12,14-15H2,(H,28,31)/p+1 |
| InChIKey | LYOBPDKQHYMQPZ-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|