C27H27N5O2 — CID 143708615
N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-2,5-dimethyl-1-(pyridin-4-ylmethyl)pyrrole-3-carboxamide (PubChem CID 143708615) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-2,5-dimethyl-1-(pyridin-4-ylmethyl)pyrrole-3-carboxamide.
| Compound Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-2,5-dimethyl-1-(pyridin-4-ylmethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 143708615 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-2,5-dimethyl-1-(pyridin-4-ylmethyl)pyrrole-3-carboxamide |
| SMILES | [H]/N=C(/CC(NC(=O)c1cc(C)n(Cc2ccncc2)c1C)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C27H27N5O2/c1-18-14-23(19(2)32(18)17-20-9-12-29-13-10-20)27(34)31-25(22-7-3-4-8-26(22)33)15-24(28)21-6-5-11-30-16-21/h3-14,16,25,28,33H,15,17H2,1-2H3,(H,31,34)/b28-24- |
| InChIKey | UWMNUJRBZCHABP-COOPMVRXSA-N |
| XLogP | 4.58 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|