C17H23Cl2N3 — CID 143710899
chloromethane;6-[(3E)-3-chloropenta-1,3-dien-2-yl]-2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine;ethane (PubChem CID 143710899) has the molecular formula C17H23Cl2N3 and a molecular weight of 340.30 g/mol. Its IUPAC name is chloromethane;6-[(3E)-3-chloropenta-1,3-dien-2-yl]-2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine;ethane.
| Compound Name | chloromethane;6-[(3E)-3-chloropenta-1,3-dien-2-yl]-2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine;ethane |
|---|---|
| PubChem CID | 143710899 |
| Molecular Formula | C17H23Cl2N3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | chloromethane;6-[(3E)-3-chloropenta-1,3-dien-2-yl]-2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine;ethane |
| SMILES | C=C(/C(Cl)=C\C)c1cc2c(nc1=C)NC(C)=NC=2.CC.CCl |
| InChI | InChI=1S/C14H14ClN3.C2H6.CH3Cl/c1-5-13(15)8(2)12-6-11-7-16-10(4)18-14(11)17-9(12)3;2*1-2/h5-7H,2-3H2,1,4H3,(H,16,17,18);1-2H3;1H3/b13-5+;; |
| InChIKey | GWIUJIYWFAVONR-IXYGCXJQSA-N |
| XLogP | 4.11 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|