C14H14ClN3 — CID 143710900
6-[(3E)-3-chloropenta-1,3-dien-2-yl]-2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine (PubChem CID 143710900) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 6-[(3E)-3-chloropenta-1,3-dien-2-yl]-2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine.
| Compound Name | 6-[(3E)-3-chloropenta-1,3-dien-2-yl]-2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 143710900 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 6-[(3E)-3-chloropenta-1,3-dien-2-yl]-2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine |
| SMILES | C=C(/C(Cl)=C\C)c1cc2c(nc1=C)NC(C)=NC=2 |
| InChI | InChI=1S/C14H14ClN3/c1-5-13(15)8(2)12-6-11-7-16-10(4)18-14(11)17-9(12)3/h5-7H,2-3H2,1,4H3,(H,16,17,18)/b13-5+ |
| InChIKey | CTBYQMASLNBPAN-WLRTZDKTSA-N |
| XLogP | 2.23 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|