C9H9N3 — CID 169254196
2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine (PubChem CID 169254196) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine.
| Compound Name | 2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 169254196 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 2-methyl-7-methylidene-1H-pyrido[2,3-d]pyrimidine |
| SMILES | C=c1ccc2c(n1)NC(C)=NC=2 |
| InChI | InChI=1S/C9H9N3/c1-6-3-4-8-5-10-7(2)12-9(8)11-6/h3-5H,1H2,2H3,(H,10,11,12) |
| InChIKey | FNSIMEYXLPLTPA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |