C35H41N5O7 — CID 143711631
tert-butyl N-[2-[[2-[4-(1-hydroxypropan-2-yl)-3-methylphenyl]-2-[(1-oxo-2H-isoquinolin-7-yl)amino]acetyl]-[(3-nitrophenyl)methyl]amino]ethyl]carbamate (PubChem CID 143711631) has the molecular formula C35H41N5O7 and a molecular weight of 643.74 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[4-(1-hydroxypropan-2-yl)-3-methylphenyl]-2-[(1-oxo-2H-isoquinolin-7-yl)amino]acetyl]-[(3-nitrophenyl)methyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[4-(1-hydroxypropan-2-yl)-3-methylphenyl]-2-[(1-oxo-2H-isoquinolin-7-yl)amino]acetyl]-[(3-nitrophenyl)methyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 143711631 |
| Molecular Formula | C35H41N5O7 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | tert-butyl N-[2-[[2-[4-(1-hydroxypropan-2-yl)-3-methylphenyl]-2-[(1-oxo-2H-isoquinolin-7-yl)amino]acetyl]-[(3-nitrophenyl)methyl]amino]ethyl]carbamate |
| SMILES | Cc1cc(C(Nc2ccc3cc[nH]c(=O)c3c2)C(=O)N(CCNC(=O)OC(C)(C)C)Cc2cccc([N+](=O)[O-])c2)ccc1C(C)CO |
| InChI | InChI=1S/C35H41N5O7/c1-22-17-26(10-12-29(22)23(2)21-41)31(38-27-11-9-25-13-14-36-32(42)30(25)19-27)33(43)39(16-15-37-34(44)47-35(3,4)5)20-24-7-6-8-28(18-24)40(45)46/h6-14,17-19,23,31,38,41H,15-16,20-21H2,1-5H3,(H,36,42)(H,37,44) |
| InChIKey | CEKZQFMIWSEQKA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 166.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|