C21H19Br2N5O3 — CID 143711819
N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-(2-methylhydrazinyl)-2-(naphthalen-2-ylamino)-3-oxopropanamide (PubChem CID 143711819) has the molecular formula C21H19Br2N5O3 and a molecular weight of 549.22 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-(2-methylhydrazinyl)-2-(naphthalen-2-ylamino)-3-oxopropanamide.
| Compound Name | N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-(2-methylhydrazinyl)-2-(naphthalen-2-ylamino)-3-oxopropanamide |
|---|---|
| PubChem CID | 143711819 |
| Molecular Formula | C21H19Br2N5O3 |
| Molecular Weight | 549.22 g/mol |
| Exact Mass | 546.99 |
| IUPAC Name | N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-(2-methylhydrazinyl)-2-(naphthalen-2-ylamino)-3-oxopropanamide |
| SMILES | CNNC(=O)C(Nc1ccc2ccccc2c1)C(=O)N/N=C/c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C21H19Br2N5O3/c1-24-27-20(30)18(26-15-7-6-13-4-2-3-5-14(13)10-15)21(31)28-25-11-12-8-16(22)19(29)17(23)9-12/h2-11,18,24,26,29H,1H3,(H,27,30)(H,28,31)/b25-11+ |
| InChIKey | SODSGUDNDQBHAF-OPEKNORGSA-N |
| XLogP | 3.25 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|