C9H11ClN2 — CID 143712668
7-chloro-3,4,6,9-tetrahydro-2H-pyrido[2,3-b]azepine (PubChem CID 143712668) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 7-chloro-3,4,6,9-tetrahydro-2H-pyrido[2,3-b]azepine.
| Compound Name | 7-chloro-3,4,6,9-tetrahydro-2H-pyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 143712668 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 7-chloro-3,4,6,9-tetrahydro-2H-pyrido[2,3-b]azepine |
| SMILES | ClC1=CNC2=NCCCC2=CC1 |
| InChI | InChI=1S/C9H11ClN2/c10-8-4-3-7-2-1-5-11-9(7)12-6-8/h3,6H,1-2,4-5H2,(H,11,12) |
| InChIKey | JWFFTTPXTMIOSA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |