C12H15ClN2 — CID 123185553
4-chloro-3,6-diethyl-1,5-dihydropyrrolo[2,3-b]azepine (PubChem CID 123185553) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 4-chloro-3,6-diethyl-1,5-dihydropyrrolo[2,3-b]azepine.
| Compound Name | 4-chloro-3,6-diethyl-1,5-dihydropyrrolo[2,3-b]azepine |
|---|---|
| PubChem CID | 123185553 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-chloro-3,6-diethyl-1,5-dihydropyrrolo[2,3-b]azepine |
| SMILES | CCC1=CN=c2[nH]cc(CC)c2=C(Cl)C1 |
| InChI | InChI=1S/C12H15ClN2/c1-3-8-5-10(13)11-9(4-2)7-15-12(11)14-6-8/h6-7H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | PPJOSTWBCZIKHW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |