C17H25ClN2 — CID 143338813
(Z)-N-[(E)-2-chloro-3-cyclopenta-1,3-dien-1-ylprop-1-enyl]-N'-methyl-2-methylidenepent-3-enimidamide;ethane (PubChem CID 143338813) has the molecular formula C17H25ClN2 and a molecular weight of 292.85 g/mol. Its IUPAC name is (Z)-N-[(E)-2-chloro-3-cyclopenta-1,3-dien-1-ylprop-1-enyl]-N'-methyl-2-methylidenepent-3-enimidamide;ethane.
| Compound Name | (Z)-N-[(E)-2-chloro-3-cyclopenta-1,3-dien-1-ylprop-1-enyl]-N'-methyl-2-methylidenepent-3-enimidamide;ethane |
|---|---|
| PubChem CID | 143338813 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (Z)-N-[(E)-2-chloro-3-cyclopenta-1,3-dien-1-ylprop-1-enyl]-N'-methyl-2-methylidenepent-3-enimidamide;ethane |
| SMILES | C=C(/C=C\C)/C(=N\C)N/C=C(/Cl)CC1=CC=CC1.CC |
| InChI | InChI=1S/C15H19ClN2.C2H6/c1-4-7-12(2)15(17-3)18-11-14(16)10-13-8-5-6-9-13;1-2/h4-8,11H,2,9-10H2,1,3H3,(H,17,18);1-2H3/b7-4-,14-11+; |
| InChIKey | QCGRUTFGMBHPEV-QBAXTUGNSA-N |
| XLogP | 5.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|