C10H10Cl2N2 — CID 163721976
4,7-dichloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine (PubChem CID 163721976) has the molecular formula C10H10Cl2N2 and a molecular weight of 229.11 g/mol. Its IUPAC name is 4,7-dichloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine.
| Compound Name | 4,7-dichloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine |
|---|---|
| PubChem CID | 163721976 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 4,7-dichloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine |
| SMILES | CCC1=C(Cl)N=c2[nH]ccc2=C(Cl)C1 |
| InChI | InChI=1S/C10H10Cl2N2/c1-2-6-5-8(11)7-3-4-13-10(7)14-9(6)12/h3-4H,2,5H2,1H3,(H,13,14) |
| InChIKey | KSIYNIUODRSZIU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|